![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| faces/ | 02-Sep-2011 11:31 | - | |
| 3877cad8.gif | 05-Jul-2011 01:21 | 52K | |
| 1194536.jpg | 24-Aug-2011 09:33 | 41K | |
| Sort_of_want_thumb.jpg | 16-Dec-2009 22:27 | 29K | |
| animated-gif-2.gif | 22-Oct-2011 16:31 | 481K | |
| darthvader.jpg | 31-Aug-2011 18:02 | 25K | |
| donotwant.png | 29-Nov-2011 03:38 | 52K | |
| e-e.gif | 22-Feb-2012 16:04 | 1.8M | |
| f753568.jpg | 22-Feb-2010 10:56 | 36K | |
| haha.jpg | 01-Aug-2009 02:26 | 56K | |
| head-guy1r.png | 01-Jun-2009 23:05 | 33K | |
| hmmm.jpg | 26-Sep-2009 23:07 | 17K | |
| killitwithfire.gif | 14-Nov-2011 22:36 | 1.1M | |
| long-neck-reaction.jpg | 16-Jun-2011 08:24 | 7.6K | |
| myeyes.gif | 31-Jan-2011 22:28 | 61K | |
| ohlaste-cz.jpg | 02-Feb-2010 14:39 | 30K | |
| rage_why.jpg | 02-Sep-2011 11:13 | 15K | |
| yummy.gif | 30-Nov-2011 21:29 | 838K | |
These files are shown for public. But after all everything is covered by its license and my rights. So you should ask if you want to use it. And piss off when you are an employee from Lidove Noviny.
